weezer010902 weezer010902
  • 03-11-2019
  • Chemistry
contestada

How many moles of oxygen are required to produce 4 moles of water?​

How many moles of oxygen are required to produce 4 moles of water class=

Respuesta :

maizetycorn
maizetycorn maizetycorn
  • 03-11-2019

Answer:

6 moles of oxygen

Explanation:We can find from the chemistry equation

C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)

6 moles O2 ~4 moles  H2O

Answer Link
soniaaguirre01234
soniaaguirre01234 soniaaguirre01234
  • 03-11-2019
6. How do I know? Just took the test boyy
Answer Link

Otras preguntas

we will make an analysis of the findings in a passive form​
How is much is 4 1/4 quarts in cups?
ما سعات التحويل الذي تحتاج إليه في عملية الضرب لتحويل الحراسات إلى كيلو جرامات ؟
What can you learn by skimming through a scientific article, identifying the parts of its structure?
How did the rise of nationalism influence the global community in the 20th century?
Which statement about topography is best supported by the information shown on this map
Why do we need to defend cultural diversity?
Brainliest to first!! Pls help!! :)
Please help. Will mark as Brainliest. ​
What group of people are responsible for setting up the Grand Princes of Russia and creating their bureaucracy, leading to Russia becoming a nation? 1 Viking 2