patriciasarria patriciasarria

01-03-2017
Mathematics

contestada

the length of a table is 6ft.on a scale drawing the length is 2 inches write three possible scales for drawing

Respuesta :

01-03-2017

You could make a 6x2 scale, 12x4 scale, and a 3x1 scale.

Answer Link

Otras preguntas

Suppose a small amount of a solid is added to water and, after a short time, all the solid has dissolved. Which of the following statements is most likely to be

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

Simplify. 2x (3-1) + 3 O 7 O 8 10 O 11

CAN ANYBODY HELP ME OUT

Please explain and help

Assign a variable solveEquation with a function expression that has three parameters (x, y, and z) and returns the result of evaluating the expression Z-y + 2 *

[tex]( \frac{3}{4} - \frac{2}{3} ) \times 1 \frac{1}{5} [/tex]

The story of Jonah is a reminder that the Lord’s plan of salvation extends beyond Israel to include all the nations, even those who were Israel’s greatest enemi

use the given information to find the new pricewholesale price: $35 markup: 95%

Given: f(x) = X2 - 3 and g(x)= x+1 The composite function g.f is a) x² + 2x - 2 b) x² + 2x c) x² - 2